C24H24ClN2S2+ — CID 11973175
2-[2-chloro-3-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)cyclohex-2-en-1-ylidene]-3-ethyl-1,3-benzothiazole (PubChem CID 11973175) has the molecular formula C24H24ClN2S2+ and a molecular weight of 440.06 g/mol. Its IUPAC name is 2-[2-chloro-3-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)cyclohex-2-en-1-ylidene]-3-ethyl-1,3-benzothiazole.
| Compound Name | 2-[2-chloro-3-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)cyclohex-2-en-1-ylidene]-3-ethyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 11973175 |
| Molecular Formula | C24H24ClN2S2+ |
| Molecular Weight | 440.06 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | 2-[2-chloro-3-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)cyclohex-2-en-1-ylidene]-3-ethyl-1,3-benzothiazole |
| SMILES | CCN1C(=C2CCCC(c3sc4ccccc4[n+]3CC)=C2Cl)Sc2ccccc21 |
| InChI | InChI=1S/C24H24ClN2S2/c1-3-26-18-12-5-7-14-20(18)28-23(26)16-10-9-11-17(22(16)25)24-27(4-2)19-13-6-8-15-21(19)29-24/h5-8,12-15H,3-4,9-11H2,1-2H3/q+1 |
| InChIKey | ORDOOBAXURYGBA-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.06 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|