C21H19N2S2+ — CID 85438539
3-ethyl-2-[3-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)prop-2-ynylidene]-1,3-benzothiazole (PubChem CID 85438539) has the molecular formula C21H19N2S2+ and a molecular weight of 363.53 g/mol. Its IUPAC name is 3-ethyl-2-[3-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)prop-2-ynylidene]-1,3-benzothiazole.
| Compound Name | 3-ethyl-2-[3-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)prop-2-ynylidene]-1,3-benzothiazole |
|---|---|
| PubChem CID | 85438539 |
| Molecular Formula | C21H19N2S2+ |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 3-ethyl-2-[3-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)prop-2-ynylidene]-1,3-benzothiazole |
| SMILES | CCN1C(=CC#Cc2sc3ccccc3[n+]2CC)Sc2ccccc21 |
| InChI | InChI=1S/C21H19N2S2/c1-3-22-16-10-5-7-12-18(16)24-20(22)14-9-15-21-23(4-2)17-11-6-8-13-19(17)25-21/h5-8,10-14H,3-4H2,1-2H3/q+1 |
| InChIKey | IFFANWNLZUSIKF-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|