C23H22Cl2N3S+ — CID 88803982
(2E)-2-[3-(5,6-dichloro-1,3-diethylbenzimidazol-3-ium-2-yl)prop-2-ynylidene]-3-ethyl-1,3-benzothiazole (PubChem CID 88803982) has the molecular formula C23H22Cl2N3S+ and a molecular weight of 443.42 g/mol. Its IUPAC name is (2E)-2-[3-(5,6-dichloro-1,3-diethylbenzimidazol-3-ium-2-yl)prop-2-ynylidene]-3-ethyl-1,3-benzothiazole.
| Compound Name | (2E)-2-[3-(5,6-dichloro-1,3-diethylbenzimidazol-3-ium-2-yl)prop-2-ynylidene]-3-ethyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 88803982 |
| Molecular Formula | C23H22Cl2N3S+ |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | (2E)-2-[3-(5,6-dichloro-1,3-diethylbenzimidazol-3-ium-2-yl)prop-2-ynylidene]-3-ethyl-1,3-benzothiazole |
| SMILES | CCN1/C(=C\C#Cc2n(CC)c3cc(Cl)c(Cl)cc3[n+]2CC)Sc2ccccc21 |
| InChI | InChI=1S/C23H22Cl2N3S/c1-4-26-19-14-16(24)17(25)15-20(19)27(5-2)22(26)12-9-13-23-28(6-3)18-10-7-8-11-21(18)29-23/h7-8,10-11,13-15H,4-6H2,1-3H3/q+1 |
| InChIKey | HOLUWRZXELSGMP-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 12.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|