C21H15N7S — CID 3730339
2-[bis(benzotriazol-1-yl)methylidene]-3-methyl-1,3-benzothiazole (PubChem CID 3730339) has the molecular formula C21H15N7S and a molecular weight of 397.47 g/mol. Its IUPAC name is 2-[bis(benzotriazol-1-yl)methylidene]-3-methyl-1,3-benzothiazole.
| Compound Name | 2-[bis(benzotriazol-1-yl)methylidene]-3-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 3730339 |
| Molecular Formula | C21H15N7S |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 2-[bis(benzotriazol-1-yl)methylidene]-3-methyl-1,3-benzothiazole |
| SMILES | CN1C(=C(n2nnc3ccccc32)n2nnc3ccccc32)Sc2ccccc21 |
| InChI | InChI=1S/C21H15N7S/c1-26-18-12-6-7-13-19(18)29-21(26)20(27-16-10-4-2-8-14(16)22-24-27)28-17-11-5-3-9-15(17)23-25-28/h2-13H,1H3 |
| InChIKey | MPFVINHGOLZTMK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 64.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |