C15H16N4 — CID 71367798
(1,3-dimethyl-2H-benzimidazol-2-yl)-phenyldiazene (PubChem CID 71367798) has the molecular formula C15H16N4 and a molecular weight of 252.32 g/mol. Its IUPAC name is (1,3-dimethyl-2H-benzimidazol-2-yl)-phenyldiazene.
| Compound Name | (1,3-dimethyl-2H-benzimidazol-2-yl)-phenyldiazene |
|---|---|
| PubChem CID | 71367798 |
| Molecular Formula | C15H16N4 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (1,3-dimethyl-2H-benzimidazol-2-yl)-phenyldiazene |
| SMILES | CN1c2ccccc2N(C)C1/N=N/c1ccccc1 |
| InChI | InChI=1S/C15H16N4/c1-18-13-10-6-7-11-14(13)19(2)15(18)17-16-12-8-4-3-5-9-12/h3-11,15H,1-2H3/b17-16+ |
| InChIKey | ACRUUFSDMXHBPJ-WUKNDPDISA-N |
| XLogP | 3.64 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|