C17H18N2 — CID 3756042
1,3-dimethyl-N-phenyl-2,3-dihydroquinolin-4-imine (PubChem CID 3756042) has the molecular formula C17H18N2 and a molecular weight of 250.35 g/mol. Its IUPAC name is 1,3-dimethyl-N-phenyl-2,3-dihydroquinolin-4-imine.
| Compound Name | 1,3-dimethyl-N-phenyl-2,3-dihydroquinolin-4-imine |
|---|---|
| PubChem CID | 3756042 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 1,3-dimethyl-N-phenyl-2,3-dihydroquinolin-4-imine |
| SMILES | CC1CN(C)c2ccccc2/C1=N/c1ccccc1 |
| InChI | InChI=1S/C17H18N2/c1-13-12-19(2)16-11-7-6-10-15(16)17(13)18-14-8-4-3-5-9-14/h3-11,13H,12H2,1-2H3/b18-17+ |
| InChIKey | HODMKYGCWCUMLU-ISLYRVAYSA-N |
| XLogP | 3.89 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|