About 3-bromo-1-methyl-2,3-dihydroquinolin-4-one
3-bromo-1-methyl-2,3-dihydroquinolin-4-one (PubChem CID 171063228) has the molecular formula C10H10BrNO
and a molecular weight of 240.10 g/mol. Its IUPAC name is 3-bromo-1-methyl-2,3-dihydroquinolin-4-one.
Molecular Properties
| Compound Name | 3-bromo-1-methyl-2,3-dihydroquinolin-4-one |
| PubChem CID | 171063228 |
| Molecular Formula | C10H10BrNO |
| Molecular Weight | 240.10 g/mol |
| Exact Mass | 238.99 |
| IUPAC Name | 3-bromo-1-methyl-2,3-dihydroquinolin-4-one |
| SMILES | CN1CC(Br)C(=O)c2ccccc21 |
| InChI | InChI=1S/C10H10BrNO/c1-12-6-8(11)10(13)7-4-2-3-5-9(7)12/h2-5,8H,6H2,1H3 |
| InChIKey | MJLFJBAENIZXSM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.10 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-1-methyl-2,3-dihydroquinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-1-methyl-2,3-dihydroquinolin-4-one?
The IUPAC name of 3-bromo-1-methyl-2,3-dihydroquinolin-4-one (CID 171063228) is 3-bromo-1-methyl-2,3-dihydroquinolin-4-one.
What is the SMILES notation for 3-bromo-1-methyl-2,3-dihydroquinolin-4-one?
The canonical SMILES for 3-bromo-1-methyl-2,3-dihydroquinolin-4-one is CN1CC(Br)C(=O)c2ccccc21.
What is the InChIKey of 3-bromo-1-methyl-2,3-dihydroquinolin-4-one?
The InChIKey is MJLFJBAENIZXSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrNO/c1-12-6-8(11)10(13)7-4-2-3-5-9(7)12/h2-5,8H,6H2,1H3.
What are the key properties of 3-bromo-1-methyl-2,3-dihydroquinolin-4-one?
3-bromo-1-methyl-2,3-dihydroquinolin-4-one has a molecular weight of 240.10 g/mol, XLogP of 2.08, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-1-methyl-2,3-dihydroquinolin-4-one is sourced from PubChem (CID 171063228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).