C11H11BrN2O2 — CID 45024476
3-bromo-1,4-dimethyl-3H-1,4-benzodiazepine-2,5-dione (PubChem CID 45024476) has the molecular formula C11H11BrN2O2 and a molecular weight of 283.12 g/mol. Its IUPAC name is 3-bromo-1,4-dimethyl-3H-1,4-benzodiazepine-2,5-dione.
| Compound Name | 3-bromo-1,4-dimethyl-3H-1,4-benzodiazepine-2,5-dione |
|---|---|
| PubChem CID | 45024476 |
| Molecular Formula | C11H11BrN2O2 |
| Molecular Weight | 283.12 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | 3-bromo-1,4-dimethyl-3H-1,4-benzodiazepine-2,5-dione |
| SMILES | CN1C(=O)C(Br)N(C)C(=O)c2ccccc21 |
| InChI | InChI=1S/C11H11BrN2O2/c1-13-8-6-4-3-5-7(8)10(15)14(2)9(12)11(13)16/h3-6,9H,1-2H3 |
| InChIKey | LTMSKLJWQWAPOB-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.12 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|