C11H11NO3 — CID 643298
(3R)-1,3-dimethyl-4,1-benzoxazepine-2,5-dione (PubChem CID 643298) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is (3R)-1,3-dimethyl-4,1-benzoxazepine-2,5-dione.
| Compound Name | (3R)-1,3-dimethyl-4,1-benzoxazepine-2,5-dione |
|---|---|
| PubChem CID | 643298 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | (3R)-1,3-dimethyl-4,1-benzoxazepine-2,5-dione |
| SMILES | C[C@H]1OC(=O)c2ccccc2N(C)C1=O |
| InChI | InChI=1S/C11H11NO3/c1-7-10(13)12(2)9-6-4-3-5-8(9)11(14)15-7/h3-7H,1-2H3/t7-/m1/s1 |
| InChIKey | MTTSVNDVSVWABY-SSDOTTSWSA-N |
| XLogP | 1.21 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |