C13H11NO2S — CID 101409668
1-methyl-2-thiophen-2-yl-2H-3,1-benzoxazin-4-one (PubChem CID 101409668) has the molecular formula C13H11NO2S and a molecular weight of 245.30 g/mol. Its IUPAC name is 1-methyl-2-thiophen-2-yl-2H-3,1-benzoxazin-4-one.
| Compound Name | 1-methyl-2-thiophen-2-yl-2H-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 101409668 |
| Molecular Formula | C13H11NO2S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 1-methyl-2-thiophen-2-yl-2H-3,1-benzoxazin-4-one |
| SMILES | CN1c2ccccc2C(=O)OC1c1cccs1 |
| InChI | InChI=1S/C13H11NO2S/c1-14-10-6-3-2-5-9(10)13(15)16-12(14)11-7-4-8-17-11/h2-8,12H,1H3 |
| InChIKey | VHJCATJYZQPIJH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |