C17H15NO3 — CID 44714874
6-benzoyl-2,4-dimethyl-1,4-benzoxazin-3-one (PubChem CID 44714874) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is 6-benzoyl-2,4-dimethyl-1,4-benzoxazin-3-one.
| Compound Name | 6-benzoyl-2,4-dimethyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 44714874 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 6-benzoyl-2,4-dimethyl-1,4-benzoxazin-3-one |
| SMILES | CC1Oc2ccc(C(=O)c3ccccc3)cc2N(C)C1=O |
| InChI | InChI=1S/C17H15NO3/c1-11-17(20)18(2)14-10-13(8-9-15(14)21-11)16(19)12-6-4-3-5-7-12/h3-11H,1-2H3 |
| InChIKey | NKHMVGVFRFCDRL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |