C16H20N2O3 — CID 51713867
(2S)-2,4-dimethyl-6-(piperidine-4-carbonyl)-1,4-benzoxazin-3-one (PubChem CID 51713867) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is (2S)-2,4-dimethyl-6-(piperidine-4-carbonyl)-1,4-benzoxazin-3-one.
| Compound Name | (2S)-2,4-dimethyl-6-(piperidine-4-carbonyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 51713867 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | (2S)-2,4-dimethyl-6-(piperidine-4-carbonyl)-1,4-benzoxazin-3-one |
| SMILES | C[C@@H]1Oc2ccc(C(=O)C3CCNCC3)cc2N(C)C1=O |
| InChI | InChI=1S/C16H20N2O3/c1-10-16(20)18(2)13-9-12(3-4-14(13)21-10)15(19)11-5-7-17-8-6-11/h3-4,9-11,17H,5-8H2,1-2H3/t10-/m0/s1 |
| InChIKey | CNGLSGOXRQPNJH-JTQLQIEISA-N |
| XLogP | 1.61 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |