C18H21N3 — CID 170842565
phenyl-(1,3,3-trimethyl-4-methylidene-2,3a-dihydroindol-2-yl)diazene (PubChem CID 170842565) has the molecular formula C18H21N3 and a molecular weight of 279.39 g/mol. Its IUPAC name is phenyl-(1,3,3-trimethyl-4-methylidene-2,3a-dihydroindol-2-yl)diazene.
| Compound Name | phenyl-(1,3,3-trimethyl-4-methylidene-2,3a-dihydroindol-2-yl)diazene |
|---|---|
| PubChem CID | 170842565 |
| Molecular Formula | C18H21N3 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | phenyl-(1,3,3-trimethyl-4-methylidene-2,3a-dihydroindol-2-yl)diazene |
| SMILES | C=C1C=CC=C2C1C(C)(C)C(/N=N/c1ccccc1)N2C |
| InChI | InChI=1S/C18H21N3/c1-13-9-8-12-15-16(13)18(2,3)17(21(15)4)20-19-14-10-6-5-7-11-14/h5-12,16-17H,1H2,2-4H3/b20-19+ |
| InChIKey | JQZBQGTVXAZYTB-FMQUCBEESA-N |
| XLogP | 4.69 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|