C13H18N2 — CID 143067263
1,4,4-trimethyl-5-methylidene-2-phenylimidazolidine (PubChem CID 143067263) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 1,4,4-trimethyl-5-methylidene-2-phenylimidazolidine.
| Compound Name | 1,4,4-trimethyl-5-methylidene-2-phenylimidazolidine |
|---|---|
| PubChem CID | 143067263 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 1,4,4-trimethyl-5-methylidene-2-phenylimidazolidine |
| SMILES | C=C1N(C)C(c2ccccc2)NC1(C)C |
| InChI | InChI=1S/C13H18N2/c1-10-13(2,3)14-12(15(10)4)11-8-6-5-7-9-11/h5-9,12,14H,1H2,2-4H3 |
| InChIKey | LFKWGVRWHPZWRP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |