C16H16N2O — CID 10192809
(2R,5R)-3-methyl-2,5-diphenylimidazolidin-4-one (PubChem CID 10192809) has the molecular formula C16H16N2O and a molecular weight of 252.32 g/mol. Its IUPAC name is (2R,5R)-3-methyl-2,5-diphenylimidazolidin-4-one.
| Compound Name | (2R,5R)-3-methyl-2,5-diphenylimidazolidin-4-one |
|---|---|
| PubChem CID | 10192809 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | (2R,5R)-3-methyl-2,5-diphenylimidazolidin-4-one |
| SMILES | CN1C(=O)[C@@H](c2ccccc2)N[C@H]1c1ccccc1 |
| InChI | InChI=1S/C16H16N2O/c1-18-15(13-10-6-3-7-11-13)17-14(16(18)19)12-8-4-2-5-9-12/h2-11,14-15,17H,1H3/t14-,15-/m1/s1 |
| InChIKey | FEMYKLDXMSRKRB-HUUCEWRRSA-N |
| XLogP | 2.49 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |