C16H21Cl3N2O3 — CID 53260184
(2R,5R)-2-tert-butyl-3-methyl-5-phenylimidazolidin-4-one;2,2,2-trichloroacetic acid (PubChem CID 53260184) has the molecular formula C16H21Cl3N2O3 and a molecular weight of 395.71 g/mol. Its IUPAC name is (2R,5R)-2-tert-butyl-3-methyl-5-phenylimidazolidin-4-one;2,2,2-trichloroacetic acid.
| Compound Name | (2R,5R)-2-tert-butyl-3-methyl-5-phenylimidazolidin-4-one;2,2,2-trichloroacetic acid |
|---|---|
| PubChem CID | 53260184 |
| Molecular Formula | C16H21Cl3N2O3 |
| Molecular Weight | 395.71 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | (2R,5R)-2-tert-butyl-3-methyl-5-phenylimidazolidin-4-one;2,2,2-trichloroacetic acid |
| SMILES | CN1C(=O)[C@@H](c2ccccc2)N[C@H]1C(C)(C)C.O=C(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H20N2O.C2HCl3O2/c1-14(2,3)13-15-11(12(17)16(13)4)10-8-6-5-7-9-10;3-2(4,5)1(6)7/h5-9,11,13,15H,1-4H3;(H,6,7)/t11-,13-;/m1./s1 |
| InChIKey | IDDOXOWTEJRPHH-LOCPCMAASA-N |
| XLogP | 3.60 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.71 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|