About [1-(2-tert-butyl-1-methyl-5-oxoimidazolidin-4-yl)-2,2,2-trifluoroethyl] benzoate
[1-(2-tert-butyl-1-methyl-5-oxoimidazolidin-4-yl)-2,2,2-trifluoroethyl] benzoate (PubChem CID 571008) has the molecular formula C17H21F3N2O3
and a molecular weight of 358.36 g/mol. Its IUPAC name is [1-(2-tert-butyl-1-methyl-5-oxoimidazolidin-4-yl)-2,2,2-trifluoroethyl] benzoate.
Molecular Properties
| Compound Name | [1-(2-tert-butyl-1-methyl-5-oxoimidazolidin-4-yl)-2,2,2-trifluoroethyl] benzoate |
| PubChem CID | 571008 |
| Molecular Formula | C17H21F3N2O3 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | [1-(2-tert-butyl-1-methyl-5-oxoimidazolidin-4-yl)-2,2,2-trifluoroethyl] benzoate |
| SMILES | CN1C(=O)C(C(OC(=O)c2ccccc2)C(F)(F)F)NC1C(C)(C)C |
| InChI | InChI=1S/C17H21F3N2O3/c1-16(2,3)15-21-11(13(23)22(15)4)12(17(18,19)20)25-14(24)10-8-6-5-7-9-10/h5-9,11-12,15,21H,1-4H3 |
| InChIKey | FPSINIFEINQTMJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-(2-tert-butyl-1-methyl-5-oxoimidazolidin-4-yl)-2,2,2-trifluoroethyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2-tert-butyl-1-methyl-5-oxoimidazolidin-4-yl)-2,2,2-trifluoroethyl] benzoate?
The IUPAC name of [1-(2-tert-butyl-1-methyl-5-oxoimidazolidin-4-yl)-2,2,2-trifluoroethyl] benzoate (CID 571008) is [1-(2-tert-butyl-1-methyl-5-oxoimidazolidin-4-yl)-2,2,2-trifluoroethyl] benzoate.
What is the SMILES notation for [1-(2-tert-butyl-1-methyl-5-oxoimidazolidin-4-yl)-2,2,2-trifluoroethyl] benzoate?
The canonical SMILES for [1-(2-tert-butyl-1-methyl-5-oxoimidazolidin-4-yl)-2,2,2-trifluoroethyl] benzoate is CN1C(=O)C(C(OC(=O)c2ccccc2)C(F)(F)F)NC1C(C)(C)C.
What is the InChIKey of [1-(2-tert-butyl-1-methyl-5-oxoimidazolidin-4-yl)-2,2,2-trifluoroethyl] benzoate?
The InChIKey is FPSINIFEINQTMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21F3N2O3/c1-16(2,3)15-21-11(13(23)22(15)4)12(17(18,19)20)25-14(24)10-8-6-5-7-9-10/h5-9,11-12,15,21H,1-4H3.
What are the key properties of [1-(2-tert-butyl-1-methyl-5-oxoimidazolidin-4-yl)-2,2,2-trifluoroethyl] benzoate?
[1-(2-tert-butyl-1-methyl-5-oxoimidazolidin-4-yl)-2,2,2-trifluoroethyl] benzoate has a molecular weight of 358.36 g/mol, XLogP of 2.58, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2-tert-butyl-1-methyl-5-oxoimidazolidin-4-yl)-2,2,2-trifluoroethyl] benzoate is sourced from PubChem (CID 571008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).