About [(1R)-1-[(2R,4S)-2-tert-butyl-1-methyl-5-oxoimidazolidin-4-yl]-2-(4-chlorophenyl)ethyl] benzoate
[(1R)-1-[(2R,4S)-2-tert-butyl-1-methyl-5-oxoimidazolidin-4-yl]-2-(4-chlorophenyl)ethyl] benzoate (PubChem CID 10093267) has the molecular formula C23H27ClN2O3
and a molecular weight of 414.93 g/mol. Its IUPAC name is [(1R)-1-[(2R,4S)-2-tert-butyl-1-methyl-5-oxoimidazolidin-4-yl]-2-(4-chlorophenyl)ethyl] benzoate.
Molecular Properties
| Compound Name | [(1R)-1-[(2R,4S)-2-tert-butyl-1-methyl-5-oxoimidazolidin-4-yl]-2-(4-chlorophenyl)ethyl] benzoate |
| PubChem CID | 10093267 |
| Molecular Formula | C23H27ClN2O3 |
| Molecular Weight | 414.93 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | [(1R)-1-[(2R,4S)-2-tert-butyl-1-methyl-5-oxoimidazolidin-4-yl]-2-(4-chlorophenyl)ethyl] benzoate |
| SMILES | CN1C(=O)[C@H]([C@@H](Cc2ccc(Cl)cc2)OC(=O)c2ccccc2)N[C@H]1C(C)(C)C |
| InChI | InChI=1S/C23H27ClN2O3/c1-23(2,3)22-25-19(20(27)26(22)4)18(14-15-10-12-17(24)13-11-15)29-21(28)16-8-6-5-7-9-16/h5-13,18-19,22,25H,14H2,1-4H3/t18-,19+,22-/m1/s1 |
| InChIKey | SGCCIINEQNJUNO-XQBPLPMBSA-N |
| XLogP | 3.91 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.93 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1R)-1-[(2R,4S)-2-tert-butyl-1-methyl-5-oxoimidazolidin-4-yl]-2-(4-chlorophenyl)ethyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-[(2R,4S)-2-tert-butyl-1-methyl-5-oxoimidazolidin-4-yl]-2-(4-chlorophenyl)ethyl] benzoate?
The IUPAC name of [(1R)-1-[(2R,4S)-2-tert-butyl-1-methyl-5-oxoimidazolidin-4-yl]-2-(4-chlorophenyl)ethyl] benzoate (CID 10093267) is [(1R)-1-[(2R,4S)-2-tert-butyl-1-methyl-5-oxoimidazolidin-4-yl]-2-(4-chlorophenyl)ethyl] benzoate.
What is the SMILES notation for [(1R)-1-[(2R,4S)-2-tert-butyl-1-methyl-5-oxoimidazolidin-4-yl]-2-(4-chlorophenyl)ethyl] benzoate?
The canonical SMILES for [(1R)-1-[(2R,4S)-2-tert-butyl-1-methyl-5-oxoimidazolidin-4-yl]-2-(4-chlorophenyl)ethyl] benzoate is CN1C(=O)[C@H]([C@@H](Cc2ccc(Cl)cc2)OC(=O)c2ccccc2)N[C@H]1C(C)(C)C.
What is the InChIKey of [(1R)-1-[(2R,4S)-2-tert-butyl-1-methyl-5-oxoimidazolidin-4-yl]-2-(4-chlorophenyl)ethyl] benzoate?
The InChIKey is SGCCIINEQNJUNO-XQBPLPMBSA-N. The full InChI is InChI=1S/C23H27ClN2O3/c1-23(2,3)22-25-19(20(27)26(22)4)18(14-15-10-12-17(24)13-11-15)29-21(28)16-8-6-5-7-9-16/h5-13,18-19,22,25H,14H2,1-4H3/t18-,19+,22-/m1/s1.
What are the key properties of [(1R)-1-[(2R,4S)-2-tert-butyl-1-methyl-5-oxoimidazolidin-4-yl]-2-(4-chlorophenyl)ethyl] benzoate?
[(1R)-1-[(2R,4S)-2-tert-butyl-1-methyl-5-oxoimidazolidin-4-yl]-2-(4-chlorophenyl)ethyl] benzoate has a molecular weight of 414.93 g/mol, XLogP of 3.91, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-[(2R,4S)-2-tert-butyl-1-methyl-5-oxoimidazolidin-4-yl]-2-(4-chlorophenyl)ethyl] benzoate is sourced from PubChem (CID 10093267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).