C17H17Cl2NO2 — CID 71516328
[(R)-azetidin-3-yl-(4-chlorophenyl)methyl] benzoate;hydrochloride (PubChem CID 71516328) has the molecular formula C17H17Cl2NO2 and a molecular weight of 338.23 g/mol. Its IUPAC name is [(R)-azetidin-3-yl-(4-chlorophenyl)methyl] benzoate;hydrochloride.
| Compound Name | [(R)-azetidin-3-yl-(4-chlorophenyl)methyl] benzoate;hydrochloride |
|---|---|
| PubChem CID | 71516328 |
| Molecular Formula | C17H17Cl2NO2 |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | [(R)-azetidin-3-yl-(4-chlorophenyl)methyl] benzoate;hydrochloride |
| SMILES | Cl.O=C(O[C@@H](c1ccc(Cl)cc1)C1CNC1)c1ccccc1 |
| InChI | InChI=1S/C17H16ClNO2.ClH/c18-15-8-6-12(7-9-15)16(14-10-19-11-14)21-17(20)13-4-2-1-3-5-13;/h1-9,14,16,19H,10-11H2;1H/t16-;/m0./s1 |
| InChIKey | OMARUGKCBCLLBE-NTISSMGPSA-N |
| XLogP | 3.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |