C16H15Cl3FNO — CID 71515620
3-[(R)-(4-chloro-3-fluorophenyl)-(3-chlorophenoxy)methyl]azetidine;hydrochloride (PubChem CID 71515620) has the molecular formula C16H15Cl3FNO and a molecular weight of 362.66 g/mol. Its IUPAC name is 3-[(R)-(4-chloro-3-fluorophenyl)-(3-chlorophenoxy)methyl]azetidine;hydrochloride.
| Compound Name | 3-[(R)-(4-chloro-3-fluorophenyl)-(3-chlorophenoxy)methyl]azetidine;hydrochloride |
|---|---|
| PubChem CID | 71515620 |
| Molecular Formula | C16H15Cl3FNO |
| Molecular Weight | 362.66 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 3-[(R)-(4-chloro-3-fluorophenyl)-(3-chlorophenoxy)methyl]azetidine;hydrochloride |
| SMILES | Cl.Fc1cc([C@H](Oc2cccc(Cl)c2)C2CNC2)ccc1Cl |
| InChI | InChI=1S/C16H14Cl2FNO.ClH/c17-12-2-1-3-13(7-12)21-16(11-8-20-9-11)10-4-5-14(18)15(19)6-10;/h1-7,11,16,20H,8-9H2;1H/t16-;/m0./s1 |
| InChIKey | ILHFTMFBWRDEJZ-NTISSMGPSA-N |
| XLogP | 4.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.66 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |