C17H17Cl2NO — CID 71516269
3-[(R)-(3,4-dichlorophenyl)-(3-methylphenoxy)methyl]azetidine (PubChem CID 71516269) has the molecular formula C17H17Cl2NO and a molecular weight of 322.24 g/mol. Its IUPAC name is 3-[(R)-(3,4-dichlorophenyl)-(3-methylphenoxy)methyl]azetidine.
| Compound Name | 3-[(R)-(3,4-dichlorophenyl)-(3-methylphenoxy)methyl]azetidine |
|---|---|
| PubChem CID | 71516269 |
| Molecular Formula | C17H17Cl2NO |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 3-[(R)-(3,4-dichlorophenyl)-(3-methylphenoxy)methyl]azetidine |
| SMILES | Cc1cccc(O[C@@H](c2ccc(Cl)c(Cl)c2)C2CNC2)c1 |
| InChI | InChI=1S/C17H17Cl2NO/c1-11-3-2-4-14(7-11)21-17(13-9-20-10-13)12-5-6-15(18)16(19)8-12/h2-8,13,17,20H,9-10H2,1H3/t17-/m0/s1 |
| InChIKey | RZFZHOLOKPTYMB-KRWDZBQOSA-N |
| XLogP | 4.64 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |