C17H15Cl4NO — CID 118706043
3-[2-(3,4-dichlorophenoxy)-2-(3,4-dichlorophenyl)ethyl]azetidine (PubChem CID 118706043) has the molecular formula C17H15Cl4NO and a molecular weight of 391.13 g/mol. Its IUPAC name is 3-[2-(3,4-dichlorophenoxy)-2-(3,4-dichlorophenyl)ethyl]azetidine.
| Compound Name | 3-[2-(3,4-dichlorophenoxy)-2-(3,4-dichlorophenyl)ethyl]azetidine |
|---|---|
| PubChem CID | 118706043 |
| Molecular Formula | C17H15Cl4NO |
| Molecular Weight | 391.13 g/mol |
| Exact Mass | 388.99 |
| IUPAC Name | 3-[2-(3,4-dichlorophenoxy)-2-(3,4-dichlorophenyl)ethyl]azetidine |
| SMILES | Clc1ccc(OC(CC2CNC2)c2ccc(Cl)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C17H15Cl4NO/c18-13-3-1-11(6-15(13)20)17(5-10-8-22-9-10)23-12-2-4-14(19)16(21)7-12/h1-4,6-7,10,17,22H,5,8-9H2 |
| InChIKey | SVQJWGJWTNGCQH-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.13 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |