C16H13Cl4NO — CID 78094523
3-[(3,4-dichlorophenoxy)-(3,4-dichlorophenyl)methyl]azetidine (PubChem CID 78094523) has the molecular formula C16H13Cl4NO and a molecular weight of 377.10 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenoxy)-(3,4-dichlorophenyl)methyl]azetidine.
| Compound Name | 3-[(3,4-dichlorophenoxy)-(3,4-dichlorophenyl)methyl]azetidine |
|---|---|
| PubChem CID | 78094523 |
| Molecular Formula | C16H13Cl4NO |
| Molecular Weight | 377.10 g/mol |
| Exact Mass | 374.98 |
| IUPAC Name | 3-[(3,4-dichlorophenoxy)-(3,4-dichlorophenyl)methyl]azetidine |
| SMILES | Clc1ccc(OC(c2ccc(Cl)c(Cl)c2)C2CNC2)cc1Cl |
| InChI | InChI=1S/C16H13Cl4NO/c17-12-3-1-9(5-14(12)19)16(10-7-21-8-10)22-11-2-4-13(18)15(20)6-11/h1-6,10,16,21H,7-8H2 |
| InChIKey | MVJFAEKRFQUMKZ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.10 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |