C16H14Cl2FNO — CID 90217872
3-[(3-chloro-4-fluorophenyl)-(4-chlorophenoxy)methyl]azetidine (PubChem CID 90217872) has the molecular formula C16H14Cl2FNO and a molecular weight of 326.20 g/mol. Its IUPAC name is 3-[(3-chloro-4-fluorophenyl)-(4-chlorophenoxy)methyl]azetidine.
| Compound Name | 3-[(3-chloro-4-fluorophenyl)-(4-chlorophenoxy)methyl]azetidine |
|---|---|
| PubChem CID | 90217872 |
| Molecular Formula | C16H14Cl2FNO |
| Molecular Weight | 326.20 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 3-[(3-chloro-4-fluorophenyl)-(4-chlorophenoxy)methyl]azetidine |
| SMILES | Fc1ccc(C(Oc2ccc(Cl)cc2)C2CNC2)cc1Cl |
| InChI | InChI=1S/C16H14Cl2FNO/c17-12-2-4-13(5-3-12)21-16(11-8-20-9-11)10-1-6-15(19)14(18)7-10/h1-7,11,16,20H,8-9H2 |
| InChIKey | RIMZPWSBOBJKLC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.20 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |