C16H15Cl2F2NO — CID 71515544
3-[(S)-(4-chloro-3-fluorophenyl)-(4-fluorophenoxy)methyl]azetidine;hydrochloride (PubChem CID 71515544) has the molecular formula C16H15Cl2F2NO and a molecular weight of 346.20 g/mol. Its IUPAC name is 3-[(S)-(4-chloro-3-fluorophenyl)-(4-fluorophenoxy)methyl]azetidine;hydrochloride.
| Compound Name | 3-[(S)-(4-chloro-3-fluorophenyl)-(4-fluorophenoxy)methyl]azetidine;hydrochloride |
|---|---|
| PubChem CID | 71515544 |
| Molecular Formula | C16H15Cl2F2NO |
| Molecular Weight | 346.20 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 3-[(S)-(4-chloro-3-fluorophenyl)-(4-fluorophenoxy)methyl]azetidine;hydrochloride |
| SMILES | Cl.Fc1ccc(O[C@H](c2ccc(Cl)c(F)c2)C2CNC2)cc1 |
| InChI | InChI=1S/C16H14ClF2NO.ClH/c17-14-6-1-10(7-15(14)19)16(11-8-20-9-11)21-13-4-2-12(18)3-5-13;/h1-7,11,16,20H,8-9H2;1H/t16-;/m1./s1 |
| InChIKey | ZVCCYHGEZXXZCR-PKLMIRHRSA-N |
| XLogP | 4.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.20 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |