C17H18Cl2FNO — CID 71515548
3-[(S)-(4-chloro-3-fluorophenyl)-(2-methylphenoxy)methyl]azetidine;hydrochloride (PubChem CID 71515548) has the molecular formula C17H18Cl2FNO and a molecular weight of 342.24 g/mol. Its IUPAC name is 3-[(S)-(4-chloro-3-fluorophenyl)-(2-methylphenoxy)methyl]azetidine;hydrochloride.
| Compound Name | 3-[(S)-(4-chloro-3-fluorophenyl)-(2-methylphenoxy)methyl]azetidine;hydrochloride |
|---|---|
| PubChem CID | 71515548 |
| Molecular Formula | C17H18Cl2FNO |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 3-[(S)-(4-chloro-3-fluorophenyl)-(2-methylphenoxy)methyl]azetidine;hydrochloride |
| SMILES | Cc1ccccc1O[C@H](c1ccc(Cl)c(F)c1)C1CNC1.Cl |
| InChI | InChI=1S/C17H17ClFNO.ClH/c1-11-4-2-3-5-16(11)21-17(13-9-20-10-13)12-6-7-14(18)15(19)8-12;/h2-8,13,17,20H,9-10H2,1H3;1H/t17-;/m1./s1 |
| InChIKey | XKCZPNFBMBHEBS-UNTBIKODSA-N |
| XLogP | 4.55 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |