C16H14ClF2NO — CID 78094255
3-[(4-chloro-3-fluorophenyl)-(4-fluorophenoxy)methyl]azetidine (PubChem CID 78094255) has the molecular formula C16H14ClF2NO and a molecular weight of 309.74 g/mol. Its IUPAC name is 3-[(4-chloro-3-fluorophenyl)-(4-fluorophenoxy)methyl]azetidine.
| Compound Name | 3-[(4-chloro-3-fluorophenyl)-(4-fluorophenoxy)methyl]azetidine |
|---|---|
| PubChem CID | 78094255 |
| Molecular Formula | C16H14ClF2NO |
| Molecular Weight | 309.74 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 3-[(4-chloro-3-fluorophenyl)-(4-fluorophenoxy)methyl]azetidine |
| SMILES | Fc1ccc(OC(c2ccc(Cl)c(F)c2)C2CNC2)cc1 |
| InChI | InChI=1S/C16H14ClF2NO/c17-14-6-1-10(7-15(14)19)16(11-8-20-9-11)21-13-4-2-12(18)3-5-13/h1-7,11,16,20H,8-9H2 |
| InChIKey | HWUFYTCFNAIIOA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.74 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |