C17H15Cl2NO2 — CID 71516067
[(S)-azetidin-3-yl-(3,4-dichlorophenyl)methyl] benzoate (PubChem CID 71516067) has the molecular formula C17H15Cl2NO2 and a molecular weight of 336.22 g/mol. Its IUPAC name is [(S)-azetidin-3-yl-(3,4-dichlorophenyl)methyl] benzoate.
| Compound Name | [(S)-azetidin-3-yl-(3,4-dichlorophenyl)methyl] benzoate |
|---|---|
| PubChem CID | 71516067 |
| Molecular Formula | C17H15Cl2NO2 |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | [(S)-azetidin-3-yl-(3,4-dichlorophenyl)methyl] benzoate |
| SMILES | O=C(O[C@H](c1ccc(Cl)c(Cl)c1)C1CNC1)c1ccccc1 |
| InChI | InChI=1S/C17H15Cl2NO2/c18-14-7-6-12(8-15(14)19)16(13-9-20-10-13)22-17(21)11-4-2-1-3-5-11/h1-8,13,16,20H,9-10H2/t16-/m1/s1 |
| InChIKey | XXXHDRXZALCTPU-MRXNPFEDSA-N |
| XLogP | 4.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |