C23H24Cl2O6 — CID 164838336
[(R)-[(3aR,4R,6R,6aR)-6-methoxy-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-yl]-(3,4-dichlorophenyl)methyl] benzoate (PubChem CID 164838336) has the molecular formula C23H24Cl2O6 and a molecular weight of 467.35 g/mol. Its IUPAC name is [(R)-[(3aR,4R,6R,6aR)-6-methoxy-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-yl]-(3,4-dichlorophenyl)methyl] benzoate.
| Compound Name | [(R)-[(3aR,4R,6R,6aR)-6-methoxy-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-yl]-(3,4-dichlorophenyl)methyl] benzoate |
|---|---|
| PubChem CID | 164838336 |
| Molecular Formula | C23H24Cl2O6 |
| Molecular Weight | 467.35 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | [(R)-[(3aR,4R,6R,6aR)-6-methoxy-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-yl]-(3,4-dichlorophenyl)methyl] benzoate |
| SMILES | CO[C@@H]1O[C@H]([C@H](OC(=O)c2ccccc2)c2ccc(Cl)c(Cl)c2)[C@@]2(C)OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C23H24Cl2O6/c1-22(2)30-19-21(27-4)29-18(23(19,3)31-22)17(14-10-11-15(24)16(25)12-14)28-20(26)13-8-6-5-7-9-13/h5-12,17-19,21H,1-4H3/t17-,18-,19+,21-,23-/m1/s1 |
| InChIKey | QFOHMNLXGYJNCL-CPHWIANGSA-N |
| XLogP | 5.17 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.35 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |