C30H29F3O6 — CID 135307569
[(R)-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-[3-methyl-4-(trifluoromethyl)phenyl]methyl] 4-phenylbenzoate (PubChem CID 135307569) has the molecular formula C30H29F3O6 and a molecular weight of 542.55 g/mol. Its IUPAC name is [(R)-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-[3-methyl-4-(trifluoromethyl)phenyl]methyl] 4-phenylbenzoate.
| Compound Name | [(R)-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-[3-methyl-4-(trifluoromethyl)phenyl]methyl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 135307569 |
| Molecular Formula | C30H29F3O6 |
| Molecular Weight | 542.55 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | [(R)-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-[3-methyl-4-(trifluoromethyl)phenyl]methyl] 4-phenylbenzoate |
| SMILES | CO[C@@H]1O[C@H]([C@H](OC(=O)c2ccc(-c3ccccc3)cc2)c2ccc(C(F)(F)F)c(C)c2)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C30H29F3O6/c1-17-16-21(14-15-22(17)30(31,32)33)23(24-25-26(28(35-4)37-24)39-29(2,3)38-25)36-27(34)20-12-10-19(11-13-20)18-8-6-5-7-9-18/h5-16,23-26,28H,1-4H3/t23-,24-,25-,26-,28-/m1/s1 |
| InChIKey | XWLAZFALMWZFFQ-RDVFURSVSA-N |
| XLogP | 6.47 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.55 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |