C12H14F2O5 — CID 89036015
[(2R)-4,4-difluoro-2-hydroperoxy-1-hydroxypentan-3-yl] benzoate (PubChem CID 89036015) has the molecular formula C12H14F2O5 and a molecular weight of 276.23 g/mol. Its IUPAC name is [(2R)-4,4-difluoro-2-hydroperoxy-1-hydroxypentan-3-yl] benzoate.
| Compound Name | [(2R)-4,4-difluoro-2-hydroperoxy-1-hydroxypentan-3-yl] benzoate |
|---|---|
| PubChem CID | 89036015 |
| Molecular Formula | C12H14F2O5 |
| Molecular Weight | 276.23 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | [(2R)-4,4-difluoro-2-hydroperoxy-1-hydroxypentan-3-yl] benzoate |
| SMILES | CC(F)(F)C(OC(=O)c1ccccc1)[C@@H](CO)OO |
| InChI | InChI=1S/C12H14F2O5/c1-12(13,14)10(9(7-15)19-17)18-11(16)8-5-3-2-4-6-8/h2-6,9-10,15,17H,7H2,1H3/t9-,10?/m1/s1 |
| InChIKey | DLGQKOKWNQIWKK-YHMJZVADSA-N |
| XLogP | 1.72 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.23 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|