About 5-phenyl-6-propyl-4,6-diazaspiro[2.4]heptan-7-one
5-phenyl-6-propyl-4,6-diazaspiro[2.4]heptan-7-one (PubChem CID 83242074) has the molecular formula C14H18N2O
and a molecular weight of 230.31 g/mol. Its IUPAC name is 5-phenyl-6-propyl-4,6-diazaspiro[2.4]heptan-7-one.
Molecular Properties
| Compound Name | 5-phenyl-6-propyl-4,6-diazaspiro[2.4]heptan-7-one |
| PubChem CID | 83242074 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 5-phenyl-6-propyl-4,6-diazaspiro[2.4]heptan-7-one |
| SMILES | CCCN1C(=O)C2(CC2)NC1c1ccccc1 |
| InChI | InChI=1S/C14H18N2O/c1-2-10-16-12(11-6-4-3-5-7-11)15-14(8-9-14)13(16)17/h3-7,12,15H,2,8-10H2,1H3 |
| InChIKey | KALVMIULTBGSMH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-phenyl-6-propyl-4,6-diazaspiro[2.4]heptan-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-6-propyl-4,6-diazaspiro[2.4]heptan-7-one?
The IUPAC name of 5-phenyl-6-propyl-4,6-diazaspiro[2.4]heptan-7-one (CID 83242074) is 5-phenyl-6-propyl-4,6-diazaspiro[2.4]heptan-7-one.
What is the SMILES notation for 5-phenyl-6-propyl-4,6-diazaspiro[2.4]heptan-7-one?
The canonical SMILES for 5-phenyl-6-propyl-4,6-diazaspiro[2.4]heptan-7-one is CCCN1C(=O)C2(CC2)NC1c1ccccc1.
What is the InChIKey of 5-phenyl-6-propyl-4,6-diazaspiro[2.4]heptan-7-one?
The InChIKey is KALVMIULTBGSMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O/c1-2-10-16-12(11-6-4-3-5-7-11)15-14(8-9-14)13(16)17/h3-7,12,15H,2,8-10H2,1H3.
What are the key properties of 5-phenyl-6-propyl-4,6-diazaspiro[2.4]heptan-7-one?
5-phenyl-6-propyl-4,6-diazaspiro[2.4]heptan-7-one has a molecular weight of 230.31 g/mol, XLogP of 2.06, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-6-propyl-4,6-diazaspiro[2.4]heptan-7-one is sourced from PubChem (CID 83242074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).