C10H8N2O3 — CID 562619
1-benzylimidazolidine-2,4,5-trione (PubChem CID 562619) has the molecular formula C10H8N2O3 and a molecular weight of 204.19 g/mol. Its IUPAC name is 1-benzylimidazolidine-2,4,5-trione.
| Compound Name | 1-benzylimidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 562619 |
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 1-benzylimidazolidine-2,4,5-trione |
| SMILES | O=C1NC(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C10H8N2O3/c13-8-9(14)12(10(15)11-8)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,11,13,15) |
| InChIKey | GGLAGGHAVVZWSQ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|