C35H29N2O4S2+ — CID 101069654
4-[[2-[2-[[3-[(4-carboxyphenyl)methyl]-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzothiazol-3-yl]methyl]benzoic acid (PubChem CID 101069654) has the molecular formula C35H29N2O4S2+ and a molecular weight of 605.76 g/mol. Its IUPAC name is 4-[[2-[2-[[3-[(4-carboxyphenyl)methyl]-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzothiazol-3-yl]methyl]benzoic acid.
| Compound Name | 4-[[2-[2-[[3-[(4-carboxyphenyl)methyl]-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzothiazol-3-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 101069654 |
| Molecular Formula | C35H29N2O4S2+ |
| Molecular Weight | 605.76 g/mol |
| Exact Mass | 605.16 |
| IUPAC Name | 4-[[2-[2-[[3-[(4-carboxyphenyl)methyl]-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzothiazol-3-yl]methyl]benzoic acid |
| SMILES | CCC(=Cc1sc2ccccc2[n+]1Cc1ccc(C(=O)O)cc1)C=C1Sc2ccccc2N1Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C35H28N2O4S2/c1-2-23(19-32-36(28-7-3-5-9-30(28)42-32)21-24-11-15-26(16-12-24)34(38)39)20-33-37(29-8-4-6-10-31(29)43-33)22-25-13-17-27(18-14-25)35(40)41/h3-20H,2,21-22H2,1H3,(H-,38,39,40,41)/p+1 |
| InChIKey | QFWQTXALDPBPQM-UHFFFAOYSA-O |
| XLogP | 8.08 |
| TPSA | 81.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.76 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|