C40H42ClN2+ — CID 72655778
2-[2-[2-chloro-3-[2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]cyclohexylidene]ethylidene]-1,1,3-trimethylbenzo[e]indole (PubChem CID 72655778) has the molecular formula C40H42ClN2+ and a molecular weight of 586.24 g/mol. Its IUPAC name is 2-[2-[2-chloro-3-[2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]cyclohexylidene]ethylidene]-1,1,3-trimethylbenzo[e]indole.
| Compound Name | 2-[2-[2-chloro-3-[2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]cyclohexylidene]ethylidene]-1,1,3-trimethylbenzo[e]indole |
|---|---|
| PubChem CID | 72655778 |
| Molecular Formula | C40H42ClN2+ |
| Molecular Weight | 586.24 g/mol |
| Exact Mass | 585.30 |
| IUPAC Name | 2-[2-[2-chloro-3-[2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]cyclohexylidene]ethylidene]-1,1,3-trimethylbenzo[e]indole |
| SMILES | CN1C(=CC=C2CCCC(C=CC3=[N+](C)c4ccc5ccccc5c4C3(C)C)C2Cl)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C40H42ClN2/c1-39(2)34(42(5)32-22-18-26-12-7-9-16-30(26)36(32)39)24-20-28-14-11-15-29(38(28)41)21-25-35-40(3,4)37-31-17-10-8-13-27(31)19-23-33(37)43(35)6/h7-10,12-13,16-25,28,38H,11,14-15H2,1-6H3/q+1 |
| InChIKey | DIFPUARILMTCFP-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.24 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|