C39H44N3O6S+ — CID 76810355
4-[[4-[2-(1-ethyl-3,3-dimethylindol-1-ium-2-yl)ethenyl]-6-(1-ethyl-3,3-dimethyl-5-sulfoindol-2-ylidene)hex-4-enoyl]amino]benzoic acid (PubChem CID 76810355) has the molecular formula C39H44N3O6S+ and a molecular weight of 682.86 g/mol. Its IUPAC name is 4-[[4-[2-(1-ethyl-3,3-dimethylindol-1-ium-2-yl)ethenyl]-6-(1-ethyl-3,3-dimethyl-5-sulfoindol-2-ylidene)hex-4-enoyl]amino]benzoic acid.
| Compound Name | 4-[[4-[2-(1-ethyl-3,3-dimethylindol-1-ium-2-yl)ethenyl]-6-(1-ethyl-3,3-dimethyl-5-sulfoindol-2-ylidene)hex-4-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 76810355 |
| Molecular Formula | C39H44N3O6S+ |
| Molecular Weight | 682.86 g/mol |
| Exact Mass | 682.29 |
| IUPAC Name | 4-[[4-[2-(1-ethyl-3,3-dimethylindol-1-ium-2-yl)ethenyl]-6-(1-ethyl-3,3-dimethyl-5-sulfoindol-2-ylidene)hex-4-enoyl]amino]benzoic acid |
| SMILES | CCN1C(=CC=C(C=CC2=[N+](CC)c3ccccc3C2(C)C)CCC(=O)Nc2ccc(C(=O)O)cc2)C(C)(C)c2cc(S(=O)(=O)O)ccc21 |
| InChI | InChI=1S/C39H43N3O6S/c1-7-41-32-12-10-9-11-30(32)38(3,4)34(41)22-13-26(15-24-36(43)40-28-18-16-27(17-19-28)37(44)45)14-23-35-39(5,6)31-25-29(49(46,47)48)20-21-33(31)42(35)8-2/h9-14,16-23,25H,7-8,15,24H2,1-6H3,(H2-,40,43,44,45,46,47,48)/p+1 |
| InChIKey | JDODSOQEMUDHJB-UHFFFAOYSA-O |
| XLogP | 7.63 |
| TPSA | 127.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.86 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|