C46H54N3O9S2+ — CID 58518994
CID 58518994 (PubChem CID 58518994) has the molecular formula C46H54N3O9S2+ and a molecular weight of 857.08 g/mol.
| Compound Name | CID 58518994 |
|---|---|
| PubChem CID | 58518994 |
| Molecular Formula | C46H54N3O9S2+ |
| Molecular Weight | 857.08 g/mol |
| Exact Mass | 856.33 |
| IUPAC Name | — |
| SMILES | [CH]CCC[N+]1=C(/C=C/C(=C/C=C/C=C2/N(CCCCS(=O)(=O)O)c3ccc(S(=O)(=O)O)cc3C2(C)C)CCC(=O)Nc2ccc(C(=O)O)cc2)C(C)(C)c2cc(C)ccc21 |
| InChI | InChI=1S/C46H53N3O9S2/c1-7-8-27-48-39-23-15-32(2)30-37(39)45(3,4)42(48)25-16-33(17-26-43(50)47-35-20-18-34(19-21-35)44(51)52)13-9-10-14-41-46(5,6)38-31-36(60(56,57)58)22-24-40(38)49(41)28-11-12-29-59(53,54)55/h1,9-10,13-16,18-25,30-31H,7-8,11-12,17,26-29H2,2-6H3,(H3-,47,50,51,52,53,54,55,56,57,58)/p+1 |
| InChIKey | DSXDRSWYLUIAEA-UHFFFAOYSA-O |
| XLogP | 8.61 |
| TPSA | 181.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.08 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|