C42H55N2O8S2+ — CID 159790448
6-[2-[2-[3-[2-[3,3-dimethyl-5-sulfo-1-(4-sulfobutyl)indol-1-ium-2-yl]ethenyl]-2-methylcyclohex-2-en-1-ylidene]ethylidene]-3,3,5-trimethylindol-1-yl]hexanoic acid (PubChem CID 159790448) has the molecular formula C42H55N2O8S2+ and a molecular weight of 780.04 g/mol. Its IUPAC name is 6-[2-[2-[3-[2-[3,3-dimethyl-5-sulfo-1-(4-sulfobutyl)indol-1-ium-2-yl]ethenyl]-2-methylcyclohex-2-en-1-ylidene]ethylidene]-3,3,5-trimethylindol-1-yl]hexanoic acid.
| Compound Name | 6-[2-[2-[3-[2-[3,3-dimethyl-5-sulfo-1-(4-sulfobutyl)indol-1-ium-2-yl]ethenyl]-2-methylcyclohex-2-en-1-ylidene]ethylidene]-3,3,5-trimethylindol-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 159790448 |
| Molecular Formula | C42H55N2O8S2+ |
| Molecular Weight | 780.04 g/mol |
| Exact Mass | 779.34 |
| IUPAC Name | 6-[2-[2-[3-[2-[3,3-dimethyl-5-sulfo-1-(4-sulfobutyl)indol-1-ium-2-yl]ethenyl]-2-methylcyclohex-2-en-1-ylidene]ethylidene]-3,3,5-trimethylindol-1-yl]hexanoic acid |
| SMILES | CC1=C(C=CC2=[N+](CCCCS(=O)(=O)O)c3ccc(S(=O)(=O)O)cc3C2(C)C)CCCC1=CC=C1N(CCCCCC(=O)O)c2ccc(C)cc2C1(C)C |
| InChI | InChI=1S/C42H54N2O8S2/c1-29-16-20-36-34(27-29)41(3,4)38(43(36)24-9-7-8-15-40(45)46)22-17-31-13-12-14-32(30(31)2)18-23-39-42(5,6)35-28-33(54(50,51)52)19-21-37(35)44(39)25-10-11-26-53(47,48)49/h16-23,27-28H,7-15,24-26H2,1-6H3,(H2-,45,46,47,48,49,50,51,52)/p+1 |
| InChIKey | DLNFNNQBKUUWOS-UHFFFAOYSA-O |
| XLogP | 8.60 |
| TPSA | 152.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.04 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|