C36H45N2O14S4+ — CID 91051718
9-[3,3-dimethyl-5-sulfo-1-(2-sulfoethyl)indol-1-ium-2-yl]-6-[3-[3,3-dimethyl-5-sulfo-1-(2-sulfoethyl)indol-2-ylidene]prop-1-enyl]nona-6,8-dienoic acid (PubChem CID 91051718) has the molecular formula C36H45N2O14S4+ and a molecular weight of 858.02 g/mol. Its IUPAC name is 9-[3,3-dimethyl-5-sulfo-1-(2-sulfoethyl)indol-1-ium-2-yl]-6-[3-[3,3-dimethyl-5-sulfo-1-(2-sulfoethyl)indol-2-ylidene]prop-1-enyl]nona-6,8-dienoic acid.
| Compound Name | 9-[3,3-dimethyl-5-sulfo-1-(2-sulfoethyl)indol-1-ium-2-yl]-6-[3-[3,3-dimethyl-5-sulfo-1-(2-sulfoethyl)indol-2-ylidene]prop-1-enyl]nona-6,8-dienoic acid |
|---|---|
| PubChem CID | 91051718 |
| Molecular Formula | C36H45N2O14S4+ |
| Molecular Weight | 858.02 g/mol |
| Exact Mass | 857.17 |
| IUPAC Name | 9-[3,3-dimethyl-5-sulfo-1-(2-sulfoethyl)indol-1-ium-2-yl]-6-[3-[3,3-dimethyl-5-sulfo-1-(2-sulfoethyl)indol-2-ylidene]prop-1-enyl]nona-6,8-dienoic acid |
| SMILES | CC1(C)C(=CC=CC(=CC=CC2=[N+](CCS(=O)(=O)O)c3ccc(S(=O)(=O)O)cc3C2(C)C)CCCCC(=O)O)N(CCS(=O)(=O)O)c2ccc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C36H44N2O14S4/c1-35(2)28-23-26(55(47,48)49)15-17-30(28)37(19-21-53(41,42)43)32(35)12-7-10-25(9-5-6-14-34(39)40)11-8-13-33-36(3,4)29-24-27(56(50,51)52)16-18-31(29)38(33)20-22-54(44,45)46/h7-8,10-13,15-18,23-24H,5-6,9,14,19-22H2,1-4H3,(H4-,39,40,41,42,43,44,45,46,47,48,49,50,51,52)/p+1 |
| InChIKey | FPBXQTVVZHZAGB-UHFFFAOYSA-O |
| XLogP | 4.70 |
| TPSA | 261.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.02 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|