C44H48N2O7S2 — CID 171129631
4-[1-ethyl-2-[3-[2-[1-ethyl-3,3-dimethyl-5-(4-sulfophenyl)indol-1-ium-2-yl]ethenyl]-6-hydroxyhex-2-enylidene]-3,3-dimethylindol-5-yl]benzenesulfonate (PubChem CID 171129631) has the molecular formula C44H48N2O7S2 and a molecular weight of 781.01 g/mol. Its IUPAC name is 4-[1-ethyl-2-[3-[2-[1-ethyl-3,3-dimethyl-5-(4-sulfophenyl)indol-1-ium-2-yl]ethenyl]-6-hydroxyhex-2-enylidene]-3,3-dimethylindol-5-yl]benzenesulfonate.
| Compound Name | 4-[1-ethyl-2-[3-[2-[1-ethyl-3,3-dimethyl-5-(4-sulfophenyl)indol-1-ium-2-yl]ethenyl]-6-hydroxyhex-2-enylidene]-3,3-dimethylindol-5-yl]benzenesulfonate |
|---|---|
| PubChem CID | 171129631 |
| Molecular Formula | C44H48N2O7S2 |
| Molecular Weight | 781.01 g/mol |
| Exact Mass | 780.29 |
| IUPAC Name | 4-[1-ethyl-2-[3-[2-[1-ethyl-3,3-dimethyl-5-(4-sulfophenyl)indol-1-ium-2-yl]ethenyl]-6-hydroxyhex-2-enylidene]-3,3-dimethylindol-5-yl]benzenesulfonate |
| SMILES | CCN1C(=CC=C(C=CC2=[N+](CC)c3ccc(-c4ccc(S(=O)(=O)O)cc4)cc3C2(C)C)CCCO)C(C)(C)c2cc(-c3ccc(S(=O)(=O)[O-])cc3)ccc21 |
| InChI | InChI=1S/C44H48N2O7S2/c1-7-45-39-23-17-33(31-13-19-35(20-14-31)54(48,49)50)28-37(39)43(3,4)41(45)25-11-30(10-9-27-47)12-26-42-44(5,6)38-29-34(18-24-40(38)46(42)8-2)32-15-21-36(22-16-32)55(51,52)53/h11-26,28-29,47H,7-10,27H2,1-6H3,(H-,48,49,50,51,52,53) |
| InChIKey | RXJRGCYNMVXGAU-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 138.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.01 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|