C42H60N3O4Si+ — CID 59707716
3-[(2E)-2-[(2E,4E,6E)-7-(3,3-dimethyl-1-propylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]-3,3-dimethylindol-1-yl]-N-(3-triethoxysilylpropyl)propanamide (PubChem CID 59707716) has the molecular formula C42H60N3O4Si+ and a molecular weight of 699.04 g/mol. Its IUPAC name is 3-[(2E)-2-[(2E,4E,6E)-7-(3,3-dimethyl-1-propylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]-3,3-dimethylindol-1-yl]-N-(3-triethoxysilylpropyl)propanamide.
| Compound Name | 3-[(2E)-2-[(2E,4E,6E)-7-(3,3-dimethyl-1-propylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]-3,3-dimethylindol-1-yl]-N-(3-triethoxysilylpropyl)propanamide |
|---|---|
| PubChem CID | 59707716 |
| Molecular Formula | C42H60N3O4Si+ |
| Molecular Weight | 699.04 g/mol |
| Exact Mass | 698.43 |
| IUPAC Name | 3-[(2E)-2-[(2E,4E,6E)-7-(3,3-dimethyl-1-propylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]-3,3-dimethylindol-1-yl]-N-(3-triethoxysilylpropyl)propanamide |
| SMILES | CCC[N+]1=C(/C=C/C=C/C=C/C=C2/N(CCC(=O)NCCC[Si](OCC)(OCC)OCC)c3ccccc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C42H59N3O4Si/c1-9-31-44-36-25-20-18-23-34(36)41(5,6)38(44)27-16-14-13-15-17-28-39-42(7,8)35-24-19-21-26-37(35)45(39)32-29-40(46)43-30-22-33-50(47-10-2,48-11-3)49-12-4/h13-21,23-28H,9-12,22,29-33H2,1-8H3/p+1 |
| InChIKey | GQPCSLDCHKJCCV-UHFFFAOYSA-O |
| XLogP | 8.77 |
| TPSA | 63.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.04 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|