C43H61N3O4S — CID 176787345
3-[2-[(1E,3E,5E)-5-[3,3-dimethyl-1-[6-(7-methyloctylamino)-6-oxohexyl]indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]propane-1-sulfonate (PubChem CID 176787345) has the molecular formula C43H61N3O4S and a molecular weight of 716.04 g/mol. Its IUPAC name is 3-[2-[(1E,3E,5E)-5-[3,3-dimethyl-1-[6-(7-methyloctylamino)-6-oxohexyl]indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]propane-1-sulfonate.
| Compound Name | 3-[2-[(1E,3E,5E)-5-[3,3-dimethyl-1-[6-(7-methyloctylamino)-6-oxohexyl]indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 176787345 |
| Molecular Formula | C43H61N3O4S |
| Molecular Weight | 716.04 g/mol |
| Exact Mass | 715.44 |
| IUPAC Name | 3-[2-[(1E,3E,5E)-5-[3,3-dimethyl-1-[6-(7-methyloctylamino)-6-oxohexyl]indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]propane-1-sulfonate |
| SMILES | CC(C)CCCCCCNC(=O)CCCCCN1/C(=C/C=C/C=C/C2=[N+](CCCS(=O)(=O)[O-])c3ccccc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C43H61N3O4S/c1-34(2)22-11-7-8-19-30-44-41(47)29-14-10-20-31-45-37-25-17-15-23-35(37)42(3,4)39(45)27-12-9-13-28-40-43(5,6)36-24-16-18-26-38(36)46(40)32-21-33-51(48,49)50/h9,12-13,15-18,23-28,34H,7-8,10-11,14,19-22,29-33H2,1-6H3,(H-,44,47,48,49,50) |
| InChIKey | CSBQWWXRPMODBN-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.04 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|