C43H49N2+ — CID 90754419
1-methyl-2-[3-[3-methyl-1-(3-methylbutyl)-3-[(4-methylphenyl)methyl]indol-2-ylidene]prop-1-enyl]spiro[benzo[g]indol-1-ium-3,1'-cyclohexane] (PubChem CID 90754419) has the molecular formula C43H49N2+ and a molecular weight of 593.88 g/mol. Its IUPAC name is 1-methyl-2-[3-[3-methyl-1-(3-methylbutyl)-3-[(4-methylphenyl)methyl]indol-2-ylidene]prop-1-enyl]spiro[benzo[g]indol-1-ium-3,1'-cyclohexane].
| Compound Name | 1-methyl-2-[3-[3-methyl-1-(3-methylbutyl)-3-[(4-methylphenyl)methyl]indol-2-ylidene]prop-1-enyl]spiro[benzo[g]indol-1-ium-3,1'-cyclohexane] |
|---|---|
| PubChem CID | 90754419 |
| Molecular Formula | C43H49N2+ |
| Molecular Weight | 593.88 g/mol |
| Exact Mass | 593.39 |
| IUPAC Name | 1-methyl-2-[3-[3-methyl-1-(3-methylbutyl)-3-[(4-methylphenyl)methyl]indol-2-ylidene]prop-1-enyl]spiro[benzo[g]indol-1-ium-3,1'-cyclohexane] |
| SMILES | Cc1ccc(CC2(C)C(=CC=CC3=[N+](C)c4c(ccc5ccccc45)C34CCCCC4)N(CCC(C)C)c3ccccc32)cc1 |
| InChI | InChI=1S/C43H49N2/c1-31(2)26-29-45-38-17-10-9-16-36(38)42(4,30-33-22-20-32(3)21-23-33)39(45)18-13-19-40-43(27-11-6-12-28-43)37-25-24-34-14-7-8-15-35(34)41(37)44(40)5/h7-10,13-25,31H,6,11-12,26-30H2,1-5H3/q+1 |
| InChIKey | XLWLCMKYYMRRMW-UHFFFAOYSA-N |
| XLogP | 10.59 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.88 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|