C39H45N4O5+ — CID 90795233
6-hydroxy-5-[2-[2-(5-methoxy-1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-5-[2-(5-methoxy-1,3,3-trimethylindol-2-ylidene)ethylidene]cyclopenten-1-yl]-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 90795233) has the molecular formula C39H45N4O5+ and a molecular weight of 649.81 g/mol. Its IUPAC name is 6-hydroxy-5-[2-[2-(5-methoxy-1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-5-[2-(5-methoxy-1,3,3-trimethylindol-2-ylidene)ethylidene]cyclopenten-1-yl]-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-[2-[2-(5-methoxy-1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-5-[2-(5-methoxy-1,3,3-trimethylindol-2-ylidene)ethylidene]cyclopenten-1-yl]-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 90795233 |
| Molecular Formula | C39H45N4O5+ |
| Molecular Weight | 649.81 g/mol |
| Exact Mass | 649.34 |
| IUPAC Name | 6-hydroxy-5-[2-[2-(5-methoxy-1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-5-[2-(5-methoxy-1,3,3-trimethylindol-2-ylidene)ethylidene]cyclopenten-1-yl]-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | COc1ccc2c(c1)C(C)(C)C(=CC=C1CCC(C=CC3=[N+](C)c4ccc(OC)cc4C3(C)C)=C1c1c(O)n(C)c(=O)n(C)c1=O)N2C |
| InChI | InChI=1S/C39H44N4O5/c1-38(2)27-21-25(47-9)15-17-29(27)40(5)31(38)19-13-23-11-12-24(33(23)34-35(44)42(7)37(46)43(8)36(34)45)14-20-32-39(3,4)28-22-26(48-10)16-18-30(28)41(32)6/h13-22H,11-12H2,1-10H3/p+1 |
| InChIKey | ZZGZXAKFOQWBGC-UHFFFAOYSA-O |
| XLogP | 5.85 |
| TPSA | 88.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.81 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|