C31H40N3O5P — CID 166502236
[(2S)-3-methoxy-2-[[(2Z)-1,3,3-trimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indole-5-carbonyl]amino]propoxy]-methylphosphinate (PubChem CID 166502236) has the molecular formula C31H40N3O5P and a molecular weight of 565.65 g/mol. Its IUPAC name is [(2S)-3-methoxy-2-[[(2Z)-1,3,3-trimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indole-5-carbonyl]amino]propoxy]-methylphosphinate.
| Compound Name | [(2S)-3-methoxy-2-[[(2Z)-1,3,3-trimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indole-5-carbonyl]amino]propoxy]-methylphosphinate |
|---|---|
| PubChem CID | 166502236 |
| Molecular Formula | C31H40N3O5P |
| Molecular Weight | 565.65 g/mol |
| Exact Mass | 565.27 |
| IUPAC Name | [(2S)-3-methoxy-2-[[(2Z)-1,3,3-trimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indole-5-carbonyl]amino]propoxy]-methylphosphinate |
| SMILES | COC[C@@H](COP(C)(=O)[O-])NC(=O)c1ccc2c(c1)C(C)(C)/C(=C/C=C/C1=[N+](C)c3ccccc3C1(C)C)N2C |
| InChI | InChI=1S/C31H40N3O5P/c1-30(2)23-12-9-10-13-25(23)33(5)27(30)14-11-15-28-31(3,4)24-18-21(16-17-26(24)34(28)6)29(35)32-22(19-38-7)20-39-40(8,36)37/h9-18,22H,19-20H2,1-8H3,(H-,32,35,36,37)/t22-/m0/s1 |
| InChIKey | YFLXTEQNPKETLN-QFIPXVFZSA-N |
| XLogP | 4.50 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.65 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|