C22H20FN3O — CID 2320265
(E,4Z)-2-cyano-N-(2-fluorophenyl)-4-(1,3,3-trimethylindol-2-ylidene)but-2-enamide (PubChem CID 2320265) has the molecular formula C22H20FN3O and a molecular weight of 361.42 g/mol. Its IUPAC name is (E,4Z)-2-cyano-N-(2-fluorophenyl)-4-(1,3,3-trimethylindol-2-ylidene)but-2-enamide.
| Compound Name | (E,4Z)-2-cyano-N-(2-fluorophenyl)-4-(1,3,3-trimethylindol-2-ylidene)but-2-enamide |
|---|---|
| PubChem CID | 2320265 |
| Molecular Formula | C22H20FN3O |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | (E,4Z)-2-cyano-N-(2-fluorophenyl)-4-(1,3,3-trimethylindol-2-ylidene)but-2-enamide |
| SMILES | CN1/C(=C\C=C(/C#N)C(=O)Nc2ccccc2F)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C22H20FN3O/c1-22(2)16-8-4-7-11-19(16)26(3)20(22)13-12-15(14-24)21(27)25-18-10-6-5-9-17(18)23/h4-13H,1-3H3,(H,25,27)/b15-12+,20-13- |
| InChIKey | ZYPWIKNESGKFPK-QIROLCGISA-N |
| XLogP | 4.53 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|