C20H18F3N5O4 — CID 4073260
2,6-dinitro-4-(trifluoromethyl)-N-[2-(1,3,3-trimethylindol-2-ylidene)ethylideneamino]aniline (PubChem CID 4073260) has the molecular formula C20H18F3N5O4 and a molecular weight of 449.39 g/mol. Its IUPAC name is 2,6-dinitro-4-(trifluoromethyl)-N-[2-(1,3,3-trimethylindol-2-ylidene)ethylideneamino]aniline.
| Compound Name | 2,6-dinitro-4-(trifluoromethyl)-N-[2-(1,3,3-trimethylindol-2-ylidene)ethylideneamino]aniline |
|---|---|
| PubChem CID | 4073260 |
| Molecular Formula | C20H18F3N5O4 |
| Molecular Weight | 449.39 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 2,6-dinitro-4-(trifluoromethyl)-N-[2-(1,3,3-trimethylindol-2-ylidene)ethylideneamino]aniline |
| SMILES | CN1C(=CC=NNc2c([N+](=O)[O-])cc(C(F)(F)F)cc2[N+](=O)[O-])C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C20H18F3N5O4/c1-19(2)13-6-4-5-7-14(13)26(3)17(19)8-9-24-25-18-15(27(29)30)10-12(20(21,22)23)11-16(18)28(31)32/h4-11,25H,1-3H3 |
| InChIKey | RTNJVATYWVVDTG-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.39 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|