C29H27N5O3 — CID 4615012
(2-methylindolizin-3-yl)-[3-nitro-4-[2-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]hydrazinyl]phenyl]methanone (PubChem CID 4615012) has the molecular formula C29H27N5O3 and a molecular weight of 493.57 g/mol. Its IUPAC name is (2-methylindolizin-3-yl)-[3-nitro-4-[2-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]hydrazinyl]phenyl]methanone.
| Compound Name | (2-methylindolizin-3-yl)-[3-nitro-4-[2-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]hydrazinyl]phenyl]methanone |
|---|---|
| PubChem CID | 4615012 |
| Molecular Formula | C29H27N5O3 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | (2-methylindolizin-3-yl)-[3-nitro-4-[2-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]hydrazinyl]phenyl]methanone |
| SMILES | Cc1cc2ccccn2c1C(=O)c1ccc(NN=CC=C2N(C)c3ccccc3C2(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H27N5O3/c1-19-17-21-9-7-8-16-33(21)27(19)28(35)20-12-13-23(25(18-20)34(36)37)31-30-15-14-26-29(2,3)22-10-5-6-11-24(22)32(26)4/h5-18,31H,1-4H3 |
| InChIKey | YVQWPCCWBRNZMN-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 92.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|