C24H17Cl3N4O3 — CID 6009505
(2-methylindolizin-3-yl)-[3-nitro-4-[(2Z)-2-[1-(2,3,4-trichlorophenyl)ethylidene]hydrazinyl]phenyl]methanone (PubChem CID 6009505) has the molecular formula C24H17Cl3N4O3 and a molecular weight of 515.78 g/mol. Its IUPAC name is (2-methylindolizin-3-yl)-[3-nitro-4-[(2Z)-2-[1-(2,3,4-trichlorophenyl)ethylidene]hydrazinyl]phenyl]methanone.
| Compound Name | (2-methylindolizin-3-yl)-[3-nitro-4-[(2Z)-2-[1-(2,3,4-trichlorophenyl)ethylidene]hydrazinyl]phenyl]methanone |
|---|---|
| PubChem CID | 6009505 |
| Molecular Formula | C24H17Cl3N4O3 |
| Molecular Weight | 515.78 g/mol |
| Exact Mass | 514.04 |
| IUPAC Name | (2-methylindolizin-3-yl)-[3-nitro-4-[(2Z)-2-[1-(2,3,4-trichlorophenyl)ethylidene]hydrazinyl]phenyl]methanone |
| SMILES | C/C(=N/Nc1ccc(C(=O)c2c(C)cc3ccccn23)cc1[N+](=O)[O-])c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C24H17Cl3N4O3/c1-13-11-16-5-3-4-10-30(16)23(13)24(32)15-6-9-19(20(12-15)31(33)34)29-28-14(2)17-7-8-18(25)22(27)21(17)26/h3-12,29H,1-2H3/b28-14- |
| InChIKey | XXSKKOUZUCLMGT-MUXKCCDJSA-N |
| XLogP | 7.18 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.78 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|