C27H24ClN3O3 — CID 4969065
[4-(azepan-1-yl)-3-nitrophenyl]-[2-(4-chlorophenyl)indolizin-3-yl]methanone (PubChem CID 4969065) has the molecular formula C27H24ClN3O3 and a molecular weight of 473.96 g/mol. Its IUPAC name is [4-(azepan-1-yl)-3-nitrophenyl]-[2-(4-chlorophenyl)indolizin-3-yl]methanone.
| Compound Name | [4-(azepan-1-yl)-3-nitrophenyl]-[2-(4-chlorophenyl)indolizin-3-yl]methanone |
|---|---|
| PubChem CID | 4969065 |
| Molecular Formula | C27H24ClN3O3 |
| Molecular Weight | 473.96 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | [4-(azepan-1-yl)-3-nitrophenyl]-[2-(4-chlorophenyl)indolizin-3-yl]methanone |
| SMILES | O=C(c1ccc(N2CCCCCC2)c([N+](=O)[O-])c1)c1c(-c2ccc(Cl)cc2)cc2ccccn12 |
| InChI | InChI=1S/C27H24ClN3O3/c28-21-11-8-19(9-12-21)23-18-22-7-3-6-16-30(22)26(23)27(32)20-10-13-24(25(17-20)31(33)34)29-14-4-1-2-5-15-29/h3,6-13,16-18H,1-2,4-5,14-15H2 |
| InChIKey | IZVLRBOWGKIPJJ-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 67.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.96 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|